CAS 1190376-20-5 appears in our catalog under these names: 4-(Phenylethynyl)benzeneboronic acid pinacol ester, 95-<97%, 4-(Phenylethynyl)benzeneboronic acid pinacol ester, ≥97-<99%, 4–(Phenylethynyl)phenylboronic acid pinacol ester, 4,4,5,5-Tetramethyl-2-(4-phenylethynyl)[1,3,2]dioxaborolane, 98%, 98%, 4,4,5,5-Tetramethyl-2-(4-(phenylethynyl)phenyl)-1,3,2-dioxaborolane, 98%. Offered by: Hoffman Fine Chemicals, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g, 1g, 250mg.
4,4,5,5-tetramethyl-2-[4-(2-phenylethynyl)phenyl]-1,3,2-dioxaborolane (CAS 1190376-20-5) is a chemical compound with the molecular formula C20H21BO2 and a molecular weight of 304.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[4-(2-phenylethynyl)phenyl]-1,3,2-dioxaborolane. InChIKey: AAIDERXZGJSORP-UHFFFAOYSA-N.
| Molecular formula | C20H21BO2 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[4-(2-phenylethynyl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | AAIDERXZGJSORP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C#CC3=CC=CC=C3 |
Computed by PubChem (NCBI)