4,4,5,5-Tetramethyl-2-(phenanthren-3-yl)-1,3,2-dioxaborolane, 95%
cas: 890042-11-2 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(phenanthren-3-yl)-1,3,2-dioxaborolane, 95% (CAS 890042-11-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A710087-250mg |
| cas | 890042-11-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 537.25 Pln | |
| Ambeed | 1g | 1321.56 Pln | |
| Ambeed | 5g | 4419.88 Pln | |
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 424.40 Pln | |
| Chemat | 1g | 1038.80 Pln | |
| Chemat | 5g | 4821.20 Pln | |
| BLDpharm | 100mg | 308.80 Pln | |
| BLDpharm | 250mg | 525.40 Pln | |
| BLDpharm | 1g | 1291.79 Pln | |
| BLDpharm | 5g | 4329.61 Pln | |
| Fluorochem | 1g | 1257.91 Pln | |
| Fluorochem | 5g | 4131.90 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4,4,5,5-tetramethyl-2-phenanthren-3-yl-1,3,2-dioxaborolane (CAS 890042-11-2) is a chemical compound with the molecular formula C20H21BO2 and a molecular weight of 304.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-phenanthren-3-yl-1,3,2-dioxaborolane. InChIKey: FAEZWACYXZQMLN-UHFFFAOYSA-N.
| Molecular formula | C20H21BO2 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-phenanthren-3-yl-1,3,2-dioxaborolane |
| InChIKey | FAEZWACYXZQMLN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)