cas: 886528-42-3 — see every product listed under this CAS number, including other names
4,4,5,5-tetramethyl-2-(4-(2,2,2-trifluoroethoxy)phenyl)-1,3,2-dioxaborolane, 98% (CAS 886528-42-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F494768-100MG |
| cas | 886528-42-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 247.85 Pln | |
| Fluorochem | 250mg | 372.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4,4,5,5-tetramethyl-2-[4-(2,2,2-trifluoroethoxy)phenyl]-1,3,2-dioxaborolane (CAS 886528-42-3) is a chemical compound with the molecular formula C14H18BF3O3 and a molecular weight of 302.10 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[4-(2,2,2-trifluoroethoxy)phenyl]-1,3,2-dioxaborolane. InChIKey: FMASTXATFLPSON-UHFFFAOYSA-N.
| Molecular formula | C14H18BF3O3 |
|---|---|
| Molecular weight | 302.10 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[4-(2,2,2-trifluoroethoxy)phenyl]-1,3,2-dioxaborolane |
| InChIKey | FMASTXATFLPSON-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCC(F)(F)F |
Computed by PubChem (NCBI)