CAS 1956334-43-2 is the registry number for 4,5,6,7–Tetrahydro–1H–4,7–methanoindole–2–carboxylic acid. Offered by: GLPBio. Available pack sizes: 25mg.
3-azatricyclo[5.2.1.02,6]deca-2(6),4-diene-4-carboxylic acid (CAS 1956334-43-2) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 3-azatricyclo[5.2.1.02,6]deca-2(6),4-diene-4-carboxylic acid. InChIKey: RUMFVVFGSCLRGD-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 3-azatricyclo[5.2.1.02,6]deca-2(6),4-diene-4-carboxylic acid |
| InChIKey | RUMFVVFGSCLRGD-UHFFFAOYSA-N |
| SMILES | C1CC2CC1C3=C2NC(=C3)C(=O)O |
Computed by PubChem (NCBI)