cas: 1951439-20-5 — see every product listed under this CAS number, including other names
4,5,6,7-tetrahydro-1H-indazol-3-amine dihydrochloride, 95% (CAS 1951439-20-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A899376-5g |
| cas | 1951439-20-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8493.94 Pln | |
| AmBeed | 10g | 14033.95 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
4,5,6,7-tetrahydro-1H-indazol-3-amine;dihydrochloride (CAS 1951439-20-5) is a chemical compound with the molecular formula C7H13Cl2N3 and a molecular weight of 210.10 g/mol. IUPAC name: 4,5,6,7-tetrahydro-1H-indazol-3-amine;dihydrochloride. InChIKey: SVSVMMDOJWEUEE-UHFFFAOYSA-N.
| Molecular formula | C7H13Cl2N3 |
|---|---|
| Molecular weight | 210.10 g/mol |
| IUPAC name | 4,5,6,7-tetrahydro-1H-indazol-3-amine;dihydrochloride |
| InChIKey | SVSVMMDOJWEUEE-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=NN2)N.Cl.Cl |
Computed by PubChem (NCBI)