CAS 26878-31-9 is the registry number for N2,N2-Dimethylpyridine-2,5-diamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-N,2-N-dimethylpyridine-2,5-diamine;dihydrochloride (CAS 26878-31-9) is a chemical compound with the molecular formula C7H13Cl2N3 and a molecular weight of 210.10 g/mol. IUPAC name: 2-N,2-N-dimethylpyridine-2,5-diamine;dihydrochloride. InChIKey: HIOPYIJWLYLCAV-UHFFFAOYSA-N.
| Molecular formula | C7H13Cl2N3 |
|---|---|
| Molecular weight | 210.10 g/mol |
| IUPAC name | 2-N,2-N-dimethylpyridine-2,5-diamine;dihydrochloride |
| InChIKey | HIOPYIJWLYLCAV-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC=C(C=C1)N.Cl.Cl |
Computed by PubChem (NCBI)