CAS 1185168-17-5 is the registry number for [(4,6-Dimethyl-2-pyrimidinyl)methyl]amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
(4,6-dimethylpyrimidin-2-yl)methanamine;dihydrochloride (CAS 1185168-17-5) is a chemical compound with the molecular formula C7H13Cl2N3 and a molecular weight of 210.10 g/mol. IUPAC name: (4,6-dimethylpyrimidin-2-yl)methanamine;dihydrochloride. InChIKey: PPWGLUJEIDHAGT-UHFFFAOYSA-N.
| Molecular formula | C7H13Cl2N3 |
|---|---|
| Molecular weight | 210.10 g/mol |
| IUPAC name | (4,6-dimethylpyrimidin-2-yl)methanamine;dihydrochloride |
| InChIKey | PPWGLUJEIDHAGT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)CN)C.Cl.Cl |
Computed by PubChem (NCBI)