CAS 1951439-20-5 appears in our catalog under these names: 4,5,6,7-Tetrahydro-1h-indazol-3-ylamine dihydrochloride, 95%, 4,5,6,7-Tetrahydro-2h-indazol-3-ylamine dihydrochloride, 95%, 4,5,6,7-tetrahydro-1H-indazol-3-amine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 1g, 5g.
4,5,6,7-tetrahydro-1H-indazol-3-amine;dihydrochloride (CAS 1951439-20-5) is a chemical compound with the molecular formula C7H13Cl2N3 and a molecular weight of 210.10 g/mol. IUPAC name: 4,5,6,7-tetrahydro-1H-indazol-3-amine;dihydrochloride. InChIKey: SVSVMMDOJWEUEE-UHFFFAOYSA-N.
| Molecular formula | C7H13Cl2N3 |
|---|---|
| Molecular weight | 210.10 g/mol |
| IUPAC name | 4,5,6,7-tetrahydro-1H-indazol-3-amine;dihydrochloride |
| InChIKey | SVSVMMDOJWEUEE-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=NN2)N.Cl.Cl |
Computed by PubChem (NCBI)