Products 74197-26-5

CAS 74197-26-5 is the registry number for 4,5,6,7-Tetrahydro-2h-indazol-6-amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4,5,6,7-tetrahydro-1H-indazol-6-amine;dihydrochloride (CAS 74197-26-5) is a chemical compound with the molecular formula C7H13Cl2N3 and a molecular weight of 210.10 g/mol. IUPAC name: 4,5,6,7-tetrahydro-1H-indazol-6-amine;dihydrochloride. InChIKey: HOFMBFYWCUCJBX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13Cl2N3
Molecular weight210.10 g/mol
IUPAC name4,5,6,7-tetrahydro-1H-indazol-6-amine;dihydrochloride
InChIKeyHOFMBFYWCUCJBX-UHFFFAOYSA-N
SMILESC1CC2=C(CC1N)NN=C2.Cl.Cl

Computed by PubChem (NCBI)