cas: 88565-88-2 — see every product listed under this CAS number, including other names
4,6,8-Trimethylquinoline, 97%, 97% (CAS 88565-88-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KIV-100mg |
| cas | 88565-88-2 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 827.60 Pln | |
| Chemat | 5g | 3098.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4,6,8-trimethylquinoline (CAS 88565-88-2) is a chemical compound with the molecular formula C12H13N and a molecular weight of 171.24 g/mol. IUPAC name: 4,6,8-trimethylquinoline. InChIKey: HNCYZWOTJQPKTQ-UHFFFAOYSA-N.
| Molecular formula | C12H13N |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | 4,6,8-trimethylquinoline |
| InChIKey | HNCYZWOTJQPKTQ-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(C=C(C2=NC=C1)C)C |
Computed by PubChem (NCBI)