CAS 88565-88-2 appears in our catalog under these names: 4,6,8-Trimethylquinoline, 95%, 4,6,8–Trimethylquinoline, 4,6,8-Trimethylquinoline, >98.0%(GC)(T), 4,6,8-Trimethylquinoline, 97%, 97%, 4,6,8-Trimethylquinoline, 97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
4,6,8-trimethylquinoline (CAS 88565-88-2) is a chemical compound with the molecular formula C12H13N and a molecular weight of 171.24 g/mol. IUPAC name: 4,6,8-trimethylquinoline. InChIKey: HNCYZWOTJQPKTQ-UHFFFAOYSA-N.
| Molecular formula | C12H13N |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | 4,6,8-trimethylquinoline |
| InChIKey | HNCYZWOTJQPKTQ-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(C=C(C2=NC=C1)C)C |
Computed by PubChem (NCBI)