cas: 1227089-74-8 — see every product listed under this CAS number, including other names
4,6-Dichloro-1-methyl-1H-pyrazolo(3,4-b)pyridine, 97% (CAS 1227089-74-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 50mg, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A563190-5g |
| cas | 1227089-74-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 11091.43 Pln | |
| AmBeed | 50mg | 642.88 Pln | |
| AmBeed | 1g | 3559.36 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4,6-dichloro-1-methylpyrazolo[5,4-b]pyridine (CAS 1227089-74-8) is a chemical compound with the molecular formula C7H5Cl2N3 and a molecular weight of 202.04 g/mol. IUPAC name: 4,6-dichloro-1-methylpyrazolo[5,4-b]pyridine. InChIKey: FNIWVSATLMFMHJ-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2N3 |
|---|---|
| Molecular weight | 202.04 g/mol |
| IUPAC name | 4,6-dichloro-1-methylpyrazolo[5,4-b]pyridine |
| InChIKey | FNIWVSATLMFMHJ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=N1)C(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)