CAS 1298031-93-2 appears in our catalog under these names: 6,8-dichloro-2-methylimidazo(1,2-b)pyridazine, 6,8-Dichloro-2-methylimidazo[1,2-b]pyridazine, 95%, 6,8-Dichloro-2-methylimidazo(1,2-b)pyridazine, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 50mg, 0,5g, 1g, 250mg, 100mg.
6,8-dichloro-2-methylimidazo[1,2-b]pyridazine (CAS 1298031-93-2) is a chemical compound with the molecular formula C7H5Cl2N3 and a molecular weight of 202.04 g/mol. IUPAC name: 6,8-dichloro-2-methylimidazo[1,2-b]pyridazine. InChIKey: HZYARHMBEOWYRA-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2N3 |
|---|---|
| Molecular weight | 202.04 g/mol |
| IUPAC name | 6,8-dichloro-2-methylimidazo[1,2-b]pyridazine |
| InChIKey | HZYARHMBEOWYRA-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=N1)C(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)