Products 1951441-48-7
CAS 1951441-48-7 appears in our catalog under these names: 4-Chloropyrido[3,2-d]pyrimidine hydrochloride, 95%, 4-CHloropyrido(3,2-d)pyrimidine hcl, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
4-chloropyrido[3,2-d]pyrimidine;hydrochloride (CAS 1951441-48-7) is a chemical compound with the molecular formula C7H5Cl2N3 and a molecular weight of 202.04 g/mol. IUPAC name: 4-chloropyrido[3,2-d]pyrimidine;hydrochloride. InChIKey: KMFGZNYFTNEMQK-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2N3 |
|---|---|
| Molecular weight | 202.04 g/mol |
| IUPAC name | 4-chloropyrido[3,2-d]pyrimidine;hydrochloride |
| InChIKey | KMFGZNYFTNEMQK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=NC=N2)Cl)N=C1.Cl |
Computed by PubChem (NCBI)