cas: 89508-47-4 — see every product listed under this CAS number, including other names
4,6-Dichloro-2-(pyridin-3-yl)pyrimidine, 98% (CAS 89508-47-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F624553-100MG |
| cas | 89508-47-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 383.22 Pln | |
| Fluorochem | 250mg | 706.02 Pln | |
| Fluorochem | 500mg | 1138.16 Pln | |
| Fluorochem | 1g | 1684.84 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4,6-dichloro-2-pyridin-3-ylpyrimidine (CAS 89508-47-4) is a chemical compound with the molecular formula C9H5Cl2N3 and a molecular weight of 226.06 g/mol. IUPAC name: 4,6-dichloro-2-pyridin-3-ylpyrimidine. InChIKey: RECDDDYREDDCDJ-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N3 |
|---|---|
| Molecular weight | 226.06 g/mol |
| IUPAC name | 4,6-dichloro-2-pyridin-3-ylpyrimidine |
| InChIKey | RECDDDYREDDCDJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NC(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)