CAS 1700-02-3 appears in our catalog under these names: 2,4–Dichloro–6–phenyl–1,3,5–triazine, 2,4-Dichloro-6-phenyl-1,3,5-triazine, >98.0%(GC), 2,4-Dichloro-6-phenyl-1,3,5-triazine 98%, 2,4-Dichloro-6-phenyl-1,3,5-triazine, 99%, 99%, 2,4-Dichloro-6-phenyl-1,3,5-triazine, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 1g, 5g, 1000g, 50g, 500g, 10g.
2,4-dichloro-6-phenyl-1,3,5-triazine (CAS 1700-02-3) is a chemical compound with the molecular formula C9H5Cl2N3 and a molecular weight of 226.06 g/mol. IUPAC name: 2,4-dichloro-6-phenyl-1,3,5-triazine. InChIKey: AMEVJOWOWQPPJQ-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N3 |
|---|---|
| Molecular weight | 226.06 g/mol |
| IUPAC name | 2,4-dichloro-6-phenyl-1,3,5-triazine |
| InChIKey | AMEVJOWOWQPPJQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)