CAS 954232-56-5 appears in our catalog under these names: 2,4-Dichloro-6-(pyridin-2-yl)pyrimidine, 95%, 2,4-Dichloro-6-(pyridin-2-yl)pyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,4-dichloro-6-pyridin-2-ylpyrimidine (CAS 954232-56-5) is a chemical compound with the molecular formula C9H5Cl2N3 and a molecular weight of 226.06 g/mol. IUPAC name: 2,4-dichloro-6-pyridin-2-ylpyrimidine. InChIKey: VONHTGNOEMMNQQ-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N3 |
|---|---|
| Molecular weight | 226.06 g/mol |
| IUPAC name | 2,4-dichloro-6-pyridin-2-ylpyrimidine |
| InChIKey | VONHTGNOEMMNQQ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)