Products 127192-16-9
CAS 127192-16-9 is the registry number for 5,6-Dichloro-1H-benzimidazole-2-acetonitrile, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(5,6-dichloro-1H-benzimidazol-2-yl)acetonitrile (CAS 127192-16-9) is a chemical compound with the molecular formula C9H5Cl2N3 and a molecular weight of 226.06 g/mol. IUPAC name: 2-(5,6-dichloro-1H-benzimidazol-2-yl)acetonitrile. InChIKey: KXVWVUXOCWRYFS-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N3 |
|---|---|
| Molecular weight | 226.06 g/mol |
| IUPAC name | 2-(5,6-dichloro-1H-benzimidazol-2-yl)acetonitrile |
| InChIKey | KXVWVUXOCWRYFS-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)N=C(N2)CC#N |
Computed by PubChem (NCBI)