Products 18520-07-5
CAS 18520-07-5 is the registry number for 2,6-Dichloro-4-ethylpyridine-3,5-dicarbonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,6-dichloro-4-ethylpyridine-3,5-dicarbonitrile (CAS 18520-07-5) is a chemical compound with the molecular formula C9H5Cl2N3 and a molecular weight of 226.06 g/mol. IUPAC name: 2,6-dichloro-4-ethylpyridine-3,5-dicarbonitrile. InChIKey: FNNCIXFVQXIZSX-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N3 |
|---|---|
| Molecular weight | 226.06 g/mol |
| IUPAC name | 2,6-dichloro-4-ethylpyridine-3,5-dicarbonitrile |
| InChIKey | FNNCIXFVQXIZSX-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=NC(=C1C#N)Cl)Cl)C#N |
Computed by PubChem (NCBI)