cas: 40020-05-1 — see every product listed under this CAS number, including other names
4,6-Dichloro-3-phenylpyridazine 95% (CAS 40020-05-1) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A934742-500g |
| cas | 40020-05-1 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 14315.56 Pln | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 464.94 Pln | |
| Ambeed | 25g | 1432.81 Pln | |
| Ambeed | 100g | 3212.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A934742 |
4,6-dichloro-3-phenylpyridazine (CAS 40020-05-1) is a chemical compound with the molecular formula C10H6Cl2N2 and a molecular weight of 225.07 g/mol. IUPAC name: 4,6-dichloro-3-phenylpyridazine. InChIKey: PPYSGGOWIZSMJL-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 4,6-dichloro-3-phenylpyridazine |
| InChIKey | PPYSGGOWIZSMJL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)