cas: 40020-05-1 — see every product listed under this CAS number, including other names
4,6-Dichloro-3-phenylpyridazine, 95%, 95% (CAS 40020-05-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BXG8-250mg |
| cas | 40020-05-1 |
| size | 250mg |
| availability | 600g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 482.00 Pln | |
| Chemat | 25g | 1542.80 Pln | |
| Chemat | 100g | 3765.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4,6-dichloro-3-phenylpyridazine (CAS 40020-05-1) is a chemical compound with the molecular formula C10H6Cl2N2 and a molecular weight of 225.07 g/mol. IUPAC name: 4,6-dichloro-3-phenylpyridazine. InChIKey: PPYSGGOWIZSMJL-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 4,6-dichloro-3-phenylpyridazine |
| InChIKey | PPYSGGOWIZSMJL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)