cas: 105776-11-2 — see every product listed under this CAS number, including other names
4,6-Dimethoxy-1H-indole-2-carboxylic acid, 95+% (CAS 105776-11-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A265344-10g |
| cas | 105776-11-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 28082.53 Pln | |
| AmBeed | 5g | 18942.49 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
4,6-dimethoxy-1H-indole-2-carboxylic acid (CAS 105776-11-2) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 4,6-dimethoxy-1H-indole-2-carboxylic acid. InChIKey: GDCKIKSQIWWVNR-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 4,6-dimethoxy-1H-indole-2-carboxylic acid |
| InChIKey | GDCKIKSQIWWVNR-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C(N2)C(=O)O)C(=C1)OC |
Computed by PubChem (NCBI)