Products 105776-11-2
CAS 105776-11-2 appears in our catalog under these names: 4,6-Dimethoxy-1H-indole-2-carboxylic acid, 4,6-Dimethoxy-1h-indole-2-carboxylic acid, 95%, 4,6-Dimethoxy-1H-indole-2-carboxylic acid, 95+%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 5g, 0,5g, 1g, 10g, 250mg, 100mg.
4,6-dimethoxy-1H-indole-2-carboxylic acid (CAS 105776-11-2) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 4,6-dimethoxy-1H-indole-2-carboxylic acid. InChIKey: GDCKIKSQIWWVNR-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 4,6-dimethoxy-1H-indole-2-carboxylic acid |
| InChIKey | GDCKIKSQIWWVNR-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C(N2)C(=O)O)C(=C1)OC |
Computed by PubChem (NCBI)