4,7-Dichloro-1,10-phenanthroline, 97%
cas: 5394-23-0 — see every product listed under this CAS number, including other names
4,7-Dichloro-1,10-phenanthroline, 97% (CAS 5394-23-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed, BLDpharm, Sigma-Aldrich.
| brand | Ambeed |
|---|---|
| catalog number | A380045-100mg |
| cas | 5394-23-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 370.38 Pln | |
| Ambeed | 25g | 1338.25 Pln | |
| Ambeed | 100g | 4136.19 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 208.84 Pln | |
| BLDpharm | 1g | 236.61 Pln | |
| BLDpharm | 5g | 397.66 Pln | |
| BLDpharm | 25g | 1441.74 Pln | |
| Sigma-Aldrich | 1G | 2040.00 Pln | |
| Sigma-Aldrich | 250MG | 885.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4,7-dichloro-1,10-phenanthroline (CAS 5394-23-0) is a chemical compound with the molecular formula C12H6Cl2N2 and a molecular weight of 249.09 g/mol. IUPAC name: 4,7-dichloro-1,10-phenanthroline. InChIKey: GIEQBYJCGYHHSU-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl2N2 |
|---|---|
| Molecular weight | 249.09 g/mol |
| IUPAC name | 4,7-dichloro-1,10-phenanthroline |
| InChIKey | GIEQBYJCGYHHSU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C3=NC=CC(=C31)Cl)Cl |
Computed by PubChem (NCBI)
