Products 5394-23-0
CAS 5394-23-0 appears in our catalog under these names: 4,7–Dichloro–1,10–phenanthroline, 4,7-Dichloro-1,10-phenanthroline, 4,7-Dichloro-1,10-phenanthroline, >98.0%(GC)(T), 4,7-Dichloro-1,10-phenanthroline 97%, 4,7-DICHLORO-1,10-PHENANTHROLINE, 97%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 5g, 10g, 25g, 200mg, 50g, 100g, 100mg.
4,7-dichloro-1,10-phenanthroline (CAS 5394-23-0) is a chemical compound with the molecular formula C12H6Cl2N2 and a molecular weight of 249.09 g/mol. IUPAC name: 4,7-dichloro-1,10-phenanthroline. InChIKey: GIEQBYJCGYHHSU-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl2N2 |
|---|---|
| Molecular weight | 249.09 g/mol |
| IUPAC name | 4,7-dichloro-1,10-phenanthroline |
| InChIKey | GIEQBYJCGYHHSU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C3=NC=CC(=C31)Cl)Cl |
Computed by PubChem (NCBI)