CAS 263012-56-2 is the registry number for 5,5'-Ethyn-1,2-diyl-bis(2-chloropyridine), 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
2-chloro-5-[2-(6-chloro-3-pyridinyl)ethynyl]pyridine (CAS 263012-56-2) is a chemical compound with the molecular formula C12H6Cl2N2 and a molecular weight of 249.09 g/mol. IUPAC name: 2-chloro-5-[2-(6-chloro-3-pyridinyl)ethynyl]pyridine. InChIKey: NCJSGJKKCBUBGM-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl2N2 |
|---|---|
| Molecular weight | 249.09 g/mol |
| IUPAC name | 2-chloro-5-[2-(6-chloro-3-pyridinyl)ethynyl]pyridine |
| InChIKey | NCJSGJKKCBUBGM-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C#CC2=CN=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)