CAS 10177-06-7 appears in our catalog under these names: 2,6-Dichloro-5-phenylnicotinonitrile, 95%, 2,6–Dichloro–5–phenylnicotinonitrile. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 10g, 25g, 5g, 1g, 100mg.
2,6-dichloro-5-phenylpyridine-3-carbonitrile (CAS 10177-06-7) is a chemical compound with the molecular formula C12H6Cl2N2 and a molecular weight of 249.09 g/mol. IUPAC name: 2,6-dichloro-5-phenylpyridine-3-carbonitrile. InChIKey: USEKKVXWLMTDNW-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl2N2 |
|---|---|
| Molecular weight | 249.09 g/mol |
| IUPAC name | 2,6-dichloro-5-phenylpyridine-3-carbonitrile |
| InChIKey | USEKKVXWLMTDNW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(C(=C2)C#N)Cl)Cl |
Computed by PubChem (NCBI)