CAS 29176-55-4 appears in our catalog under these names: 2,9–Dichloro–1,10–phenanthroline, 2,9-Dichloro-1,10-phenanthroline, >97.0%(GC)(T), 2,9-Dichloro-1,10-phenanthroline 95%, 2,9-Dichloro-1,10-phenanthroline, 98%, 98%, 2,9-Dichloro-1,10-phenanthroline, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 200mg, 1g, 250mg, 100g, 250g.
2,9-dichloro-1,10-phenanthroline (CAS 29176-55-4) is a chemical compound with the molecular formula C12H6Cl2N2 and a molecular weight of 249.09 g/mol. IUPAC name: 2,9-dichloro-1,10-phenanthroline. InChIKey: DNKGIDURJINUOA-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl2N2 |
|---|---|
| Molecular weight | 249.09 g/mol |
| IUPAC name | 2,9-dichloro-1,10-phenanthroline |
| InChIKey | DNKGIDURJINUOA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C1C=CC(=N3)Cl)N=C(C=C2)Cl |
Computed by PubChem (NCBI)