cas: 3248-05-3 — see every product listed under this CAS number, including other names
4,7-Dimethyl-1,10-phenanthroline, 98%, 98% (CAS 3248-05-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 15g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144VM-250mg |
| cas | 3248-05-3 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 606.80 Pln | |
| Chemat | 10g | 1130.00 Pln | |
| Chemat | 15g | 1614.80 Pln | |
| Chemat | 25g | 2555.60 Pln | |
| Chemat | 100g | 9280.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4,7-dimethyl-1,10-phenanthroline (CAS 3248-05-3) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 4,7-dimethyl-1,10-phenanthroline. InChIKey: JIVLDFFWTQYGSR-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 4,7-dimethyl-1,10-phenanthroline |
| InChIKey | JIVLDFFWTQYGSR-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC3=C(C=CN=C3C2=NC=C1)C |
Computed by PubChem (NCBI)