Products 308134-34-1
CAS 308134-34-1 is the registry number for 4,7-Dimethyl-1,10-phenanthroline monohydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 10g, 1g.
4,7-dimethyl-1,10-phenanthroline (CAS 308134-34-1) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 4,7-dimethyl-1,10-phenanthroline. InChIKey: JIVLDFFWTQYGSR-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 4,7-dimethyl-1,10-phenanthroline |
| InChIKey | JIVLDFFWTQYGSR-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC3=C(C=CN=C3C2=NC=C1)C |
Computed by PubChem (NCBI)
Synonyms:
4,7-Dimethyl-1,10-phenanthroline, 1,10-Phenanthroline, 4,7-dimethyl-, 4,7-Dimethyl-o-phenanthroline, 4,7-Dimethyl-(1,10)phenanthroline, 4,7Dimethylophenanthroline, 1,10Phenanthroline, 4,7dimethyl, JIVLDFFWTQYGSR-UHFFFAOYSA-N, 1,10-phenanthroline, 4,7-dimethyl-, hydrate, 4,7-dimethylpyridino[3,2-h]quinoline, Oprea1_825186