CAS 51339-40-3 is the registry number for 3-Bromo-5-nitrobenzoyl chloride, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
3-bromo-5-nitrobenzoyl chloride (CAS 51339-40-3) is a chemical compound with the molecular formula C7H3BrClNO3 and a molecular weight of 264.46 g/mol. IUPAC name: 3-bromo-5-nitrobenzoyl chloride. InChIKey: ZFZCKJACMSJUOK-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNO3 |
|---|---|
| Molecular weight | 264.46 g/mol |
| IUPAC name | 3-bromo-5-nitrobenzoyl chloride |
| InChIKey | ZFZCKJACMSJUOK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])Br)C(=O)Cl |
Computed by PubChem (NCBI)