Products 51339-40-3

CAS 51339-40-3 is the registry number for 3-Bromo-5-nitrobenzoyl chloride, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

3-bromo-5-nitrobenzoyl chloride (CAS 51339-40-3) is a chemical compound with the molecular formula C7H3BrClNO3 and a molecular weight of 264.46 g/mol. IUPAC name: 3-bromo-5-nitrobenzoyl chloride. InChIKey: ZFZCKJACMSJUOK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3BrClNO3
Molecular weight264.46 g/mol
IUPAC name3-bromo-5-nitrobenzoyl chloride
InChIKeyZFZCKJACMSJUOK-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1[N+](=O)[O-])Br)C(=O)Cl

Computed by PubChem (NCBI)