CAS 1174534-43-0 is the registry number for 4-Bromo-2-chloro-5-nitrobenzaldehyde, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 250mg.
4-bromo-2-chloro-5-nitrobenzaldehyde (CAS 1174534-43-0) is a chemical compound with the molecular formula C7H3BrClNO3 and a molecular weight of 264.46 g/mol. IUPAC name: 4-bromo-2-chloro-5-nitrobenzaldehyde. InChIKey: SZFZZHPEEGSQIL-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNO3 |
|---|---|
| Molecular weight | 264.46 g/mol |
| IUPAC name | 4-bromo-2-chloro-5-nitrobenzaldehyde |
| InChIKey | SZFZZHPEEGSQIL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])Br)Cl)C=O |
Computed by PubChem (NCBI)