CAS 80887-01-0 is the registry number for 2-Bromo-5-nitrobenzoyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 10g.
2-bromo-5-nitrobenzoyl chloride (CAS 80887-01-0) is a chemical compound with the molecular formula C7H3BrClNO3 and a molecular weight of 264.46 g/mol. IUPAC name: 2-bromo-5-nitrobenzoyl chloride. InChIKey: ZXJNUFQVJRBJJY-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNO3 |
|---|---|
| Molecular weight | 264.46 g/mol |
| IUPAC name | 2-bromo-5-nitrobenzoyl chloride |
| InChIKey | ZXJNUFQVJRBJJY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(=O)Cl)Br |
Computed by PubChem (NCBI)