cas: 90035-34-0 — see every product listed under this CAS number, including other names
4′-Trifluoromethylbiphenyl-4-carboxaldehyde, 97%, 97% (CAS 90035-34-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117LHR-1g |
| cas | 90035-34-0 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 25g | 530.00 Pln | |
| Chemat | 10g | 290.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-[4-(trifluoromethyl)phenyl]benzaldehyde (CAS 90035-34-0) is a chemical compound with the molecular formula C14H9F3O and a molecular weight of 250.21 g/mol. IUPAC name: 4-[4-(trifluoromethyl)phenyl]benzaldehyde. InChIKey: HIMSXOOFWOOYFK-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O |
|---|---|
| Molecular weight | 250.21 g/mol |
| IUPAC name | 4-[4-(trifluoromethyl)phenyl]benzaldehyde |
| InChIKey | HIMSXOOFWOOYFK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)