cas: 1187525-03-6 — see every product listed under this CAS number, including other names
4,4,5,5-tetramethyl-2-(2-phenylprop-1-en-1-yl)-1,3,2-dioxaborolane (CAS 1187525-03-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12WJN7-100mg |
| cas | 1187525-03-6 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 500mg | 861.20 Pln | |
| Chemat | 1g | 1350.80 Pln |
| delivery time | 3 weeks |
|---|
4,4,5,5-tetramethyl-2-(2-phenylprop-1-enyl)-1,3,2-dioxaborolane (CAS 1187525-03-6) is a chemical compound with the molecular formula C15H21BO2 and a molecular weight of 244.14 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-phenylprop-1-enyl)-1,3,2-dioxaborolane. InChIKey: UWZANNWZLJPRSC-UHFFFAOYSA-N.
| Molecular formula | C15H21BO2 |
|---|---|
| Molecular weight | 244.14 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-phenylprop-1-enyl)-1,3,2-dioxaborolane |
| InChIKey | UWZANNWZLJPRSC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C=C(C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)