cas: 377085-56-8 — see every product listed under this CAS number, including other names
4-(((Pentyloxy)carbonyl)oxy)benzoic acid (CAS 377085-56-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F756279-1G |
| cas | 377085-56-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2658.46 Pln |
| delivery time | 3-4 weeks |
|---|
4-pentoxycarbonyloxybenzoic acid (CAS 377085-56-8) is a chemical compound with the molecular formula C13H16O5 and a molecular weight of 252.26 g/mol. IUPAC name: 4-pentoxycarbonyloxybenzoic acid. InChIKey: RMIZZENBDILCRU-UHFFFAOYSA-N.
| Molecular formula | C13H16O5 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | 4-pentoxycarbonyloxybenzoic acid |
| InChIKey | RMIZZENBDILCRU-UHFFFAOYSA-N |
| SMILES | CCCCCOC(=O)OC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)