cas: 263270-62-8 — see every product listed under this CAS number, including other names
4-((2-Methylthiazol-4-yl)methoxy)benzoic acid, ≥98%, ≥98% (CAS 263270-62-8) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I61C-5mg |
| cas | 263270-62-8 |
| size | 5mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 803.60 Pln | |
| Chemat | 10mg | 1245.20 Pln | |
| Chemat | 25mg | 2426.00 Pln | |
| Chemat | 50mg | 3842.00 Pln | |
| Chemat | 100mg | 6126.80 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoic acid (CAS 263270-62-8) is a chemical compound with the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. IUPAC name: 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoic acid. InChIKey: XLAHFZQELKMMMP-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3S |
|---|---|
| Molecular weight | 249.29 g/mol |
| IUPAC name | 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoic acid |
| InChIKey | XLAHFZQELKMMMP-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)COC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)