cas: 97042-18-7 — see every product listed under this CAS number, including other names
4-((4-(Allyloxy)phenyl)sulfonyl)phenol 96% (CAS 97042-18-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A159848-250mg |
| cas | 97042-18-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 748.62 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A159848 |
4-(4-prop-2-enoxyphenyl)sulfonylphenol (CAS 97042-18-7) is a chemical compound with the molecular formula C15H14O4S and a molecular weight of 290.3 g/mol. IUPAC name: 4-(4-prop-2-enoxyphenyl)sulfonylphenol. InChIKey: FKZIDBGIZLBDDF-UHFFFAOYSA-N.
| Molecular formula | C15H14O4S |
|---|---|
| Molecular weight | 290.3 g/mol |
| IUPAC name | 4-(4-prop-2-enoxyphenyl)sulfonylphenol |
| InChIKey | FKZIDBGIZLBDDF-UHFFFAOYSA-N |
| SMILES | C=CCOC1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)