cas: 97042-18-7 — see every product listed under this CAS number, including other names
4-((4-(Allyloxy)phenyl)sulfonyl)phenol, 98%, 98% (CAS 97042-18-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116S05-1g |
| cas | 97042-18-7 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 198.80 Pln | |
| Chemat | 10g | 270.80 Pln | |
| Chemat | 25g | 477.20 Pln | |
| Chemat | 100g | 1302.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(4-prop-2-enoxyphenyl)sulfonylphenol (CAS 97042-18-7) is a chemical compound with the molecular formula C15H14O4S and a molecular weight of 290.3 g/mol. IUPAC name: 4-(4-prop-2-enoxyphenyl)sulfonylphenol. InChIKey: FKZIDBGIZLBDDF-UHFFFAOYSA-N.
| Molecular formula | C15H14O4S |
|---|---|
| Molecular weight | 290.3 g/mol |
| IUPAC name | 4-(4-prop-2-enoxyphenyl)sulfonylphenol |
| InChIKey | FKZIDBGIZLBDDF-UHFFFAOYSA-N |
| SMILES | C=CCOC1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)