CAS 168618-75-5 is the registry number for methyl 3-(2-methanesulfonylphenyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 3-(2-methylsulfonylphenyl)benzoate (CAS 168618-75-5) is a chemical compound with the molecular formula C15H14O4S and a molecular weight of 290.3 g/mol. IUPAC name: methyl 3-(2-methylsulfonylphenyl)benzoate. InChIKey: SQZRULCITAIFQY-UHFFFAOYSA-N.
| Molecular formula | C15H14O4S |
|---|---|
| Molecular weight | 290.3 g/mol |
| IUPAC name | methyl 3-(2-methylsulfonylphenyl)benzoate |
| InChIKey | SQZRULCITAIFQY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C2=CC=CC=C2S(=O)(=O)C |
Computed by PubChem (NCBI)