CAS 110046-36-1 appears in our catalog under these names: 4-([(4-Methylbenzene)sulfonyl]methyl)benzoic acid, 95%, 4-((4-Methylbenzenesulfonyl)methyl)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
4-[(4-methylphenyl)sulfonylmethyl]benzoic acid (CAS 110046-36-1) is a chemical compound with the molecular formula C15H14O4S and a molecular weight of 290.3 g/mol. IUPAC name: 4-[(4-methylphenyl)sulfonylmethyl]benzoic acid. InChIKey: TYRULJCOYHWOKV-UHFFFAOYSA-N.
| Molecular formula | C15H14O4S |
|---|---|
| Molecular weight | 290.3 g/mol |
| IUPAC name | 4-[(4-methylphenyl)sulfonylmethyl]benzoic acid |
| InChIKey | TYRULJCOYHWOKV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)CC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)