CAS 923281-47-4 is the registry number for 4-Methoxy-2'-(methylsulfonyl)biphenyl-3-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-methoxy-5-(2-methylsulfonylphenyl)benzaldehyde (CAS 923281-47-4) is a chemical compound with the molecular formula C15H14O4S and a molecular weight of 290.3 g/mol. IUPAC name: 2-methoxy-5-(2-methylsulfonylphenyl)benzaldehyde. InChIKey: XYCJZCKEVORYFQ-UHFFFAOYSA-N.
| Molecular formula | C15H14O4S |
|---|---|
| Molecular weight | 290.3 g/mol |
| IUPAC name | 2-methoxy-5-(2-methylsulfonylphenyl)benzaldehyde |
| InChIKey | XYCJZCKEVORYFQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC=CC=C2S(=O)(=O)C)C=O |
Computed by PubChem (NCBI)