cas: 28122-52-3 — see every product listed under this CAS number, including other names
4-(1,1,3,3-tetramethylbutyl)benzene-1,3-diol, 99% (CAS 28122-52-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F373491-250MG |
| cas | 28122-52-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 253.05 Pln | |
| Fluorochem | 5g | 706.02 Pln | |
| Fluorochem | 25g | 3278.03 Pln |
| purity | 99% |
|---|---|
| delivery time | 3-4 weeks |
4-(2,4,4-trimethylpentan-2-yl)benzene-1,3-diol (CAS 28122-52-3) is a chemical compound with the molecular formula C14H22O2 and a molecular weight of 222.32 g/mol. IUPAC name: 4-(2,4,4-trimethylpentan-2-yl)benzene-1,3-diol. InChIKey: YQOJNENEFSZINP-UHFFFAOYSA-N.
| Molecular formula | C14H22O2 |
|---|---|
| Molecular weight | 222.32 g/mol |
| IUPAC name | 4-(2,4,4-trimethylpentan-2-yl)benzene-1,3-diol |
| InChIKey | YQOJNENEFSZINP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)C1=C(C=C(C=C1)O)O |
Computed by PubChem (NCBI)