cas: 28122-52-3 — see every product listed under this CAS number, including other names
4-tert-Octylresorcinol, >99.0%(GC) (CAS 28122-52-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | O0048-5G |
| cas | 28122-52-3 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 1116.55 Pln | |
| TCI | 25g | 4401.27 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >99.0%(GC) |
4-(2,4,4-trimethylpentan-2-yl)benzene-1,3-diol (CAS 28122-52-3) is a chemical compound with the molecular formula C14H22O2 and a molecular weight of 222.32 g/mol. IUPAC name: 4-(2,4,4-trimethylpentan-2-yl)benzene-1,3-diol. InChIKey: YQOJNENEFSZINP-UHFFFAOYSA-N.
| Molecular formula | C14H22O2 |
|---|---|
| Molecular weight | 222.32 g/mol |
| IUPAC name | 4-(2,4,4-trimethylpentan-2-yl)benzene-1,3-diol |
| InChIKey | YQOJNENEFSZINP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)C1=C(C=C(C=C1)O)O |
Computed by PubChem (NCBI)