cas: 28122-52-3 — see every product listed under this CAS number, including other names
4-(2,4,4-Trimethylpentan-2-yl)benzene-1,3-diol, 97%, 97% (CAS 28122-52-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114M3F-1g |
| cas | 28122-52-3 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 290.00 Pln | |
| Chemat | 10g | 501.20 Pln | |
| Chemat | 25g | 1106.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(2,4,4-trimethylpentan-2-yl)benzene-1,3-diol (CAS 28122-52-3) is a chemical compound with the molecular formula C14H22O2 and a molecular weight of 222.32 g/mol. IUPAC name: 4-(2,4,4-trimethylpentan-2-yl)benzene-1,3-diol. InChIKey: YQOJNENEFSZINP-UHFFFAOYSA-N.
| Molecular formula | C14H22O2 |
|---|---|
| Molecular weight | 222.32 g/mol |
| IUPAC name | 4-(2,4,4-trimethylpentan-2-yl)benzene-1,3-diol |
| InChIKey | YQOJNENEFSZINP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)C1=C(C=C(C=C1)O)O |
Computed by PubChem (NCBI)