cas: 105297-10-7 — see every product listed under this CAS number, including other names
4-(1,1-Dioxidothiomorpholin-4-yl)aniline 98% (CAS 105297-10-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A300383-250mg |
| cas | 105297-10-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1037.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A300383 |
4-(1,1-dioxo-1,4-thiazinan-4-yl)aniline (CAS 105297-10-7) is a chemical compound with the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. IUPAC name: 4-(1,1-dioxo-1,4-thiazinan-4-yl)aniline. InChIKey: PLQZCPNIYKUNPR-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2S |
|---|---|
| Molecular weight | 226.30 g/mol |
| IUPAC name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)aniline |
| InChIKey | PLQZCPNIYKUNPR-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)