cas: 10314-06-4 — see every product listed under this CAS number, including other names
4-(1,3-Dioxoisoindolin-2-yl)butanoyl chloride 95% (CAS 10314-06-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A348616-250mg |
| cas | 10314-06-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 270.25 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 1510.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A348616 |
4-(1,3-dioxoisoindol-2-yl)butanoyl chloride (CAS 10314-06-4) is a chemical compound with the molecular formula C12H10ClNO3 and a molecular weight of 251.66 g/mol. IUPAC name: 4-(1,3-dioxoisoindol-2-yl)butanoyl chloride. InChIKey: STXHPGKNMJVJKL-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | 4-(1,3-dioxoisoindol-2-yl)butanoyl chloride |
| InChIKey | STXHPGKNMJVJKL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCCC(=O)Cl |
Computed by PubChem (NCBI)