CAS 1133115-50-0 is the registry number for Methyl 4-chloro-7-methoxyquinoline-2-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 25g, 5g.
Methyl 4-chloro-7-methoxyquinoline-2-carboxylate (CAS 1133115-50-0) is a chemical compound with the molecular formula C12H10ClNO3 and a molecular weight of 251.66 g/mol. IUPAC name: methyl 4-chloro-7-methoxyquinoline-2-carboxylate. InChIKey: OTOZREHULJJZJV-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | methyl 4-chloro-7-methoxyquinoline-2-carboxylate |
| InChIKey | OTOZREHULJJZJV-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=CC(=N2)C(=O)OC)Cl |
Computed by PubChem (NCBI)