cas: 10314-06-4 — see every product listed under this CAS number, including other names
4-(1,3-Dioxoisoindolin-2-yl)butanoyl chloride, 95%, 95% (CAS 10314-06-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119U7Z-250mg |
| cas | 10314-06-4 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 414.80 Pln | |
| Chemat | 5g | 1298.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(1,3-dioxoisoindol-2-yl)butanoyl chloride (CAS 10314-06-4) is a chemical compound with the molecular formula C12H10ClNO3 and a molecular weight of 251.66 g/mol. IUPAC name: 4-(1,3-dioxoisoindol-2-yl)butanoyl chloride. InChIKey: STXHPGKNMJVJKL-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | 4-(1,3-dioxoisoindol-2-yl)butanoyl chloride |
| InChIKey | STXHPGKNMJVJKL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCCC(=O)Cl |
Computed by PubChem (NCBI)