CAS 66176-24-7 appears in our catalog under these names: 6-Chloro-1-ethyl-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, 95%, 6-Chloro-1-ethyl-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
6-chloro-1-ethyl-4-oxoquinoline-3-carboxylic acid (CAS 66176-24-7) is a chemical compound with the molecular formula C12H10ClNO3 and a molecular weight of 251.66 g/mol. IUPAC name: 6-chloro-1-ethyl-4-oxoquinoline-3-carboxylic acid. InChIKey: YVRGGPBWRTYCDP-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | 6-chloro-1-ethyl-4-oxoquinoline-3-carboxylic acid |
| InChIKey | YVRGGPBWRTYCDP-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=C1C=CC(=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)